C9H14O3 — CID 13112444
2-(2-methyl-1,3-dioxolan-2-yl)cyclopentan-1-one (PubChem CID 13112444) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dioxolan-2-yl)cyclopentan-1-one.
| Compound Name | 2-(2-methyl-1,3-dioxolan-2-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 13112444 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-(2-methyl-1,3-dioxolan-2-yl)cyclopentan-1-one |
| SMILES | CC1(C2CCCC2=O)OCCO1 |
| InChI | InChI=1S/C9H14O3/c1-9(11-5-6-12-9)7-3-2-4-8(7)10/h7H,2-6H2,1H3 |
| InChIKey | CRJJLTPVGUWHIY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |