C14H22O3 — CID 135131074
(4'aR,5'R,8'aR)-5',8'a-dimethylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one (PubChem CID 135131074) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (4'aR,5'R,8'aR)-5',8'a-dimethylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one.
| Compound Name | (4'aR,5'R,8'aR)-5',8'a-dimethylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 135131074 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (4'aR,5'R,8'aR)-5',8'a-dimethylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
| SMILES | C[C@@H]1[C@H]2CCCC(=O)[C@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C14H22O3/c1-10-11-4-3-5-12(15)13(11,2)6-7-14(10)16-8-9-17-14/h10-11H,3-9H2,1-2H3/t10-,11-,13-/m1/s1 |
| InChIKey | IODJNNKRQJTWEJ-NQBHXWOUSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |