C25H26FN3O3 — CID 137293879
(6'aR,7'R,10'aR)-2'-(8-fluoroquinolin-4-yl)-7',10'a-dimethylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one (PubChem CID 137293879) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is (6'aR,7'R,10'aR)-2'-(8-fluoroquinolin-4-yl)-7',10'a-dimethylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one.
| Compound Name | (6'aR,7'R,10'aR)-2'-(8-fluoroquinolin-4-yl)-7',10'a-dimethylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one |
|---|---|
| PubChem CID | 137293879 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (6'aR,7'R,10'aR)-2'-(8-fluoroquinolin-4-yl)-7',10'a-dimethylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one |
| SMILES | C[C@@H]1[C@H]2CCc3c(nc(-c4ccnc5c(F)cccc45)[nH]c3=O)[C@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C25H26FN3O3/c1-14-18-7-6-17-21(24(18,2)9-10-25(14)31-12-13-32-25)28-22(29-23(17)30)16-8-11-27-20-15(16)4-3-5-19(20)26/h3-5,8,11,14,18H,6-7,9-10,12-13H2,1-2H3,(H,28,29,30)/t14-,18-,24-/m1/s1 |
| InChIKey | NEXFIFHMZSBTDE-CLNHLTTHSA-N |
| XLogP | 4.12 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |