C31H35FN4O3 — CID 146539779
(6'aR,7'R,10'aR)-4'-(2-fluorophenyl)-7',10'a-dimethyl-2'-(2-morpholin-4-yl-4-pyridinyl)spiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] (PubChem CID 146539779) has the molecular formula C31H35FN4O3 and a molecular weight of 530.64 g/mol. Its IUPAC name is (6'aR,7'R,10'aR)-4'-(2-fluorophenyl)-7',10'a-dimethyl-2'-(2-morpholin-4-yl-4-pyridinyl)spiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline].
| Compound Name | (6'aR,7'R,10'aR)-4'-(2-fluorophenyl)-7',10'a-dimethyl-2'-(2-morpholin-4-yl-4-pyridinyl)spiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
|---|---|
| PubChem CID | 146539779 |
| Molecular Formula | C31H35FN4O3 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (6'aR,7'R,10'aR)-4'-(2-fluorophenyl)-7',10'a-dimethyl-2'-(2-morpholin-4-yl-4-pyridinyl)spiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
| SMILES | C[C@@H]1[C@H]2CCc3c(-c4ccccc4F)nc(-c4ccnc(N5CCOCC5)c4)nc3[C@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C31H35FN4O3/c1-20-24-8-7-23-27(22-5-3-4-6-25(22)32)34-29(21-9-12-33-26(19-21)36-13-15-37-16-14-36)35-28(23)30(24,2)10-11-31(20)38-17-18-39-31/h3-6,9,12,19-20,24H,7-8,10-11,13-18H2,1-2H3/t20-,24-,30-/m1/s1 |
| InChIKey | KRDQQQRZLQPIGP-YMLOERMTSA-N |
| XLogP | 5.17 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |