C29H29FN4O3S — CID 153485451
(6aR,7R,11aR)-2-[2-(ethylsulfonylmethyl)-4-pyridinyl]-4-(2-fluorophenyl)-7,11a-dimethyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline (PubChem CID 153485451) has the molecular formula C29H29FN4O3S and a molecular weight of 532.64 g/mol. Its IUPAC name is (6aR,7R,11aR)-2-[2-(ethylsulfonylmethyl)-4-pyridinyl]-4-(2-fluorophenyl)-7,11a-dimethyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline.
| Compound Name | (6aR,7R,11aR)-2-[2-(ethylsulfonylmethyl)-4-pyridinyl]-4-(2-fluorophenyl)-7,11a-dimethyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline |
|---|---|
| PubChem CID | 153485451 |
| Molecular Formula | C29H29FN4O3S |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | (6aR,7R,11aR)-2-[2-(ethylsulfonylmethyl)-4-pyridinyl]-4-(2-fluorophenyl)-7,11a-dimethyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline |
| SMILES | CCS(=O)(=O)Cc1cc(-c2nc(-c3ccccc3F)c3c(n2)[C@]2(C)Cc4cnoc4[C@H](C)[C@H]2CC3)ccn1 |
| InChI | InChI=1S/C29H29FN4O3S/c1-4-38(35,36)16-20-13-18(11-12-31-20)28-33-25(21-7-5-6-8-24(21)30)22-9-10-23-17(2)26-19(15-32-37-26)14-29(23,3)27(22)34-28/h5-8,11-13,15,17,23H,4,9-10,14,16H2,1-3H3/t17-,23-,29-/m1/s1 |
| InChIKey | YJJINXUQHMFUBK-QZZDXIJXSA-N |
| XLogP | 5.45 |
| TPSA | 98.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |