C28H25FN4O3S — CID 135131833
(6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-[2-(methylsulfonylmethyl)-4-pyridinyl]-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131833) has the molecular formula C28H25FN4O3S and a molecular weight of 516.60 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-[2-(methylsulfonylmethyl)-4-pyridinyl]-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-[2-(methylsulfonylmethyl)-4-pyridinyl]-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131833 |
| Molecular Formula | C28H25FN4O3S |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-[2-(methylsulfonylmethyl)-4-pyridinyl]-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccnc(CS(C)(=O)=O)c4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C28H25FN4O3S/c1-16-22-9-8-21-24(20-6-4-5-7-23(20)29)32-27(17-10-11-31-19(12-17)15-37(3,35)36)33-26(21)28(22,2)13-18(14-30)25(16)34/h4-7,10-13,16,22H,8-9,15H2,1-3H3/t16-,22-,28-/m1/s1 |
| InChIKey | BGFSNNKTRZIPKK-ZCRVEVSISA-N |
| XLogP | 4.38 |
| TPSA | 113.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |