C29H28FN3O4 — CID 135132114
3-[4-[(6aR,7R,9Z,10aR)-4-(2-fluorophenyl)-9-(hydroxymethylidene)-7,10a-dimethyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-2-yl]-2-pyridinyl]propanoic acid (PubChem CID 135132114) has the molecular formula C29H28FN3O4 and a molecular weight of 501.56 g/mol. Its IUPAC name is 3-[4-[(6aR,7R,9Z,10aR)-4-(2-fluorophenyl)-9-(hydroxymethylidene)-7,10a-dimethyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-2-yl]-2-pyridinyl]propanoic acid.
| Compound Name | 3-[4-[(6aR,7R,9Z,10aR)-4-(2-fluorophenyl)-9-(hydroxymethylidene)-7,10a-dimethyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-2-yl]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 135132114 |
| Molecular Formula | C29H28FN3O4 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 3-[4-[(6aR,7R,9Z,10aR)-4-(2-fluorophenyl)-9-(hydroxymethylidene)-7,10a-dimethyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-2-yl]-2-pyridinyl]propanoic acid |
| SMILES | C[C@H]1C(=O)/C(=C\O)C[C@@]2(C)c3nc(-c4ccnc(CCC(=O)O)c4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C29H28FN3O4/c1-16-22-9-8-21-25(20-5-3-4-6-23(20)30)32-28(17-11-12-31-19(13-17)7-10-24(35)36)33-27(21)29(22,2)14-18(15-34)26(16)37/h3-6,11-13,15-16,22,34H,7-10,14H2,1-2H3,(H,35,36)/b18-15-/t16-,22-,29-/m1/s1 |
| InChIKey | LHWKWQHSGLXOHM-LPDBYRAASA-N |
| XLogP | 5.23 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|