C31H28FN3O — CID 135131608
(6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(2-phenyl-4-pyridinyl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 135131608) has the molecular formula C31H28FN3O and a molecular weight of 477.58 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(2-phenyl-4-pyridinyl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(2-phenyl-4-pyridinyl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 135131608 |
| Molecular Formula | C31H28FN3O |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(2-phenyl-4-pyridinyl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | C[C@H]1C(=O)CC[C@@]2(C)c3nc(-c4ccnc(-c5ccccc5)c4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C31H28FN3O/c1-19-24-13-12-23-28(22-10-6-7-11-25(22)32)34-30(35-29(23)31(24,2)16-14-27(19)36)21-15-17-33-26(18-21)20-8-4-3-5-9-20/h3-11,15,17-19,24H,12-14,16H2,1-2H3/t19-,24-,31-/m1/s1 |
| InChIKey | BYXZYSINKCUXOG-NFRYOZPQSA-N |
| XLogP | 6.83 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |