C31H31FN4O — CID 153485567
(6aS,7R,10aR)-2-(2-cyclopropyl-4-pyridinyl)-7-ethyl-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-6,6a,9,10-tetrahydro-5H-benzo[h]quinazolin-8-one (PubChem CID 153485567) has the molecular formula C31H31FN4O and a molecular weight of 494.61 g/mol. Its IUPAC name is (6aS,7R,10aR)-2-(2-cyclopropyl-4-pyridinyl)-7-ethyl-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-6,6a,9,10-tetrahydro-5H-benzo[h]quinazolin-8-one.
| Compound Name | (6aS,7R,10aR)-2-(2-cyclopropyl-4-pyridinyl)-7-ethyl-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-6,6a,9,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485567 |
| Molecular Formula | C31H31FN4O |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | (6aS,7R,10aR)-2-(2-cyclopropyl-4-pyridinyl)-7-ethyl-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-6,6a,9,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1C[C@@]2(C)c3nc(-c4ccnc(C5CC5)c4)nc(-c4ccccc4F)c3CC[C@@H]2[C@@](C)(CC)C1=O |
| InChI | InChI=1S/C31H31FN4O/c1-5-30(2)25-13-12-21-26(20-8-6-7-9-22(20)32)35-29(19-14-15-34-23(16-19)18-10-11-18)36-27(21)31(25,3)17-24(33-4)28(30)37/h6-9,14-16,18,24-25H,5,10-13,17H2,1-3H3/t24?,25-,30-,31-/m1/s1 |
| InChIKey | LOUGYDWVUKMTKQ-UHEDVBMGSA-N |
| XLogP | 6.72 |
| TPSA | 60.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|