C31H34FN3O2 — CID 135132200
(6'aR,10'aR)-2'-(2-cyclopropyl-4-pyridinyl)-4'-(2-fluorophenyl)-10'a-propylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] (PubChem CID 135132200) has the molecular formula C31H34FN3O2 and a molecular weight of 499.63 g/mol. Its IUPAC name is (6'aR,10'aR)-2'-(2-cyclopropyl-4-pyridinyl)-4'-(2-fluorophenyl)-10'a-propylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline].
| Compound Name | (6'aR,10'aR)-2'-(2-cyclopropyl-4-pyridinyl)-4'-(2-fluorophenyl)-10'a-propylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
|---|---|
| PubChem CID | 135132200 |
| Molecular Formula | C31H34FN3O2 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (6'aR,10'aR)-2'-(2-cyclopropyl-4-pyridinyl)-4'-(2-fluorophenyl)-10'a-propylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
| SMILES | CCC[C@@]12CCC3(C[C@H]1CCc1c(-c4ccccc4F)nc(-c4ccnc(C5CC5)c4)nc12)OCCO3 |
| InChI | InChI=1S/C31H34FN3O2/c1-2-12-30-13-14-31(36-16-17-37-31)19-22(30)9-10-24-27(23-5-3-4-6-25(23)32)34-29(35-28(24)30)21-11-15-33-26(18-21)20-7-8-20/h3-6,11,15,18,20,22H,2,7-10,12-14,16-17,19H2,1H3/t22-,30-/m1/s1 |
| InChIKey | LUMQSHWVSQYCRX-YKGWIAGDSA-N |
| XLogP | 6.75 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |