C30H25FN4O — CID 153485662
(6aS,7S,10aR)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 153485662) has the molecular formula C30H25FN4O and a molecular weight of 476.56 g/mol. Its IUPAC name is (6aS,7S,10aR)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S,10aR)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485662 |
| Molecular Formula | C30H25FN4O |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | (6aS,7S,10aR)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1C[C@@]2(C)c3nc(-c4ccnc5ccccc45)nc(-c4ccccc4F)c3CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C30H25FN4O/c1-17-22-13-12-21-26(20-9-4-6-10-23(20)31)34-29(19-14-15-33-24-11-7-5-8-18(19)24)35-28(21)30(22,2)16-25(32-3)27(17)36/h4-11,14-15,17,22,25H,12-13,16H2,1-2H3/t17-,22-,25?,30+/m0/s1 |
| InChIKey | VWZUKCNCCMIFEO-WBCJWJRVSA-N |
| XLogP | 6.21 |
| TPSA | 60.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|