C27H25FN4O — CID 153485612
(6aR,7R,10aR)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-(3-methyl-4-pyridinyl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol (PubChem CID 153485612) has the molecular formula C27H25FN4O and a molecular weight of 440.52 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-(3-methyl-4-pyridinyl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol.
| Compound Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-(3-methyl-4-pyridinyl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol |
|---|---|
| PubChem CID | 153485612 |
| Molecular Formula | C27H25FN4O |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-(3-methyl-4-pyridinyl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol |
| SMILES | [C-]#[N+]C1=C(O)[C@H](C)[C@H]2CCc3c(-c4ccccc4F)nc(-c4ccncc4C)nc3[C@]2(C)C1 |
| InChI | InChI=1S/C27H25FN4O/c1-15-14-30-12-11-17(15)26-31-23(18-7-5-6-8-21(18)28)19-9-10-20-16(2)24(33)22(29-4)13-27(20,3)25(19)32-26/h5-8,11-12,14,16,20,33H,9-10,13H2,1-3H3/t16-,20-,27-/m1/s1 |
| InChIKey | KQFNMCOGVQPCQP-PJIRNLIGSA-N |
| XLogP | 6.20 |
| TPSA | 63.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|