C27H30FN5O2 — CID 135131906
(6aR,7R,10aR)-2-(4-acetylpiperazin-1-yl)-4-(2-fluorophenyl)-8-hydroxy-7,10a-dimethyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazoline-9-carbonitrile (PubChem CID 135131906) has the molecular formula C27H30FN5O2 and a molecular weight of 475.57 g/mol. Its IUPAC name is (6aR,7R,10aR)-2-(4-acetylpiperazin-1-yl)-4-(2-fluorophenyl)-8-hydroxy-7,10a-dimethyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aR)-2-(4-acetylpiperazin-1-yl)-4-(2-fluorophenyl)-8-hydroxy-7,10a-dimethyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131906 |
| Molecular Formula | C27H30FN5O2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (6aR,7R,10aR)-2-(4-acetylpiperazin-1-yl)-4-(2-fluorophenyl)-8-hydroxy-7,10a-dimethyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazoline-9-carbonitrile |
| SMILES | CC(=O)N1CCN(c2nc(-c3ccccc3F)c3c(n2)[C@]2(C)CC(C#N)=C(O)[C@H](C)[C@H]2CC3)CC1 |
| InChI | InChI=1S/C27H30FN5O2/c1-16-21-9-8-20-23(19-6-4-5-7-22(19)28)30-26(33-12-10-32(11-13-33)17(2)34)31-25(20)27(21,3)14-18(15-29)24(16)35/h4-7,16,21,35H,8-14H2,1-3H3/t16-,21-,27-/m1/s1 |
| InChIKey | GXXVSOYLZJUPGV-YIPKYWMUSA-N |
| XLogP | 4.15 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |