C30H30FN5O2 — CID 135132032
(6aR,7R,10aR)-4-(2-fluorophenyl)-8-hydroxy-7,10a-dimethyl-2-(2-morpholin-4-yl-4-pyridinyl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazoline-9-carbonitrile (PubChem CID 135132032) has the molecular formula C30H30FN5O2 and a molecular weight of 511.60 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-(2-fluorophenyl)-8-hydroxy-7,10a-dimethyl-2-(2-morpholin-4-yl-4-pyridinyl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-8-hydroxy-7,10a-dimethyl-2-(2-morpholin-4-yl-4-pyridinyl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135132032 |
| Molecular Formula | C30H30FN5O2 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-8-hydroxy-7,10a-dimethyl-2-(2-morpholin-4-yl-4-pyridinyl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(O)=C(C#N)C[C@@]2(C)c3nc(-c4ccnc(N5CCOCC5)c4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C30H30FN5O2/c1-18-23-8-7-22-26(21-5-3-4-6-24(21)31)34-29(35-28(22)30(23,2)16-20(17-32)27(18)37)19-9-10-33-25(15-19)36-11-13-38-14-12-36/h3-6,9-10,15,18,23,37H,7-8,11-14,16H2,1-2H3/t18-,23-,30-/m1/s1 |
| InChIKey | UOTUUIGFUHTUMU-JGCPLDISSA-N |
| XLogP | 5.38 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |