C27H26N4O — CID 153485551
(6aR,7R,10aR)-9-isocyano-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-4-phenyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol (PubChem CID 153485551) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is (6aR,7R,10aR)-9-isocyano-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-4-phenyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol.
| Compound Name | (6aR,7R,10aR)-9-isocyano-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-4-phenyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol |
|---|---|
| PubChem CID | 153485551 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (6aR,7R,10aR)-9-isocyano-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-4-phenyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol |
| SMILES | [C-]#[N+]C1=C(O)[C@H](C)[C@H]2CCc3c(-c4ccccc4)nc(-c4ccnc(C)c4)nc3[C@]2(C)C1 |
| InChI | InChI=1S/C27H26N4O/c1-16-14-19(12-13-29-16)26-30-23(18-8-6-5-7-9-18)20-10-11-21-17(2)24(32)22(28-4)15-27(21,3)25(20)31-26/h5-9,12-14,17,21,32H,10-11,15H2,1-3H3/t17-,21-,27-/m1/s1 |
| InChIKey | AIBAKWMBIJAPHJ-OYBFMBOMSA-N |
| XLogP | 6.06 |
| TPSA | 63.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|