C27H23N5OS — CID 153485605
(6aR,7R,10aR)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-4-(1,3-thiazol-2-yl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol (PubChem CID 153485605) has the molecular formula C27H23N5OS and a molecular weight of 465.58 g/mol. Its IUPAC name is (6aR,7R,10aR)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-4-(1,3-thiazol-2-yl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol.
| Compound Name | (6aR,7R,10aR)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-4-(1,3-thiazol-2-yl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol |
|---|---|
| PubChem CID | 153485605 |
| Molecular Formula | C27H23N5OS |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (6aR,7R,10aR)-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-4-(1,3-thiazol-2-yl)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol |
| SMILES | [C-]#[N+]C1=C(O)[C@H](C)[C@H]2CCc3c(-c4nccs4)nc(-c4ccnc5ccccc45)nc3[C@]2(C)C1 |
| InChI | InChI=1S/C27H23N5OS/c1-15-19-9-8-18-22(26-30-12-13-34-26)31-25(17-10-11-29-20-7-5-4-6-16(17)20)32-24(18)27(19,2)14-21(28-3)23(15)33/h4-7,10-13,15,19,33H,8-9,14H2,1-2H3/t15-,19-,27-/m1/s1 |
| InChIKey | NOPICDMCVHSORU-NIGURAHDSA-N |
| XLogP | 6.36 |
| TPSA | 76.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|