C30H30N4O2 — CID 147689958
(6aR,7R,10aS)-4-cyclohexyloxy-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 147689958) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-cyclohexyloxy-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-4-cyclohexyloxy-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 147689958 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (6aR,7R,10aS)-4-cyclohexyloxy-9-isocyano-7,10a-dimethyl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4ccnc5ccccc45)nc(OC4CCCCC4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C30H30N4O2/c1-18-23-14-13-22-27(30(23,2)17-25(31-3)26(18)35)33-28(34-29(22)36-19-9-5-4-6-10-19)21-15-16-32-24-12-8-7-11-20(21)24/h7-8,11-12,15-19,23H,4-6,9-10,13-14H2,1-2H3/t18-,23-,30-/m1/s1 |
| InChIKey | GQTWQCKKAPUBQY-JGCPLDISSA-N |
| XLogP | 6.25 |
| TPSA | 69.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|