C29H28N4O2 — CID 146502891
(6aR,7R,10aS)-4-cyclobutyloxy-7,10a-dimethyl-2-(2-methylquinolin-4-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 146502891) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-cyclobutyloxy-7,10a-dimethyl-2-(2-methylquinolin-4-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-cyclobutyloxy-7,10a-dimethyl-2-(2-methylquinolin-4-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 146502891 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (6aR,7R,10aS)-4-cyclobutyloxy-7,10a-dimethyl-2-(2-methylquinolin-4-yl)-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | Cc1cc(-c2nc(OC3CCC3)c3c(n2)[C@]2(C)C=C(C#N)C(=O)[C@H](C)[C@H]2CC3)c2ccccc2n1 |
| InChI | InChI=1S/C29H28N4O2/c1-16-13-22(20-9-4-5-10-24(20)31-16)27-32-26-21(28(33-27)35-19-7-6-8-19)11-12-23-17(2)25(34)18(15-30)14-29(23,26)3/h4-5,9-10,13-14,17,19,23H,6-8,11-12H2,1-3H3/t17-,23-,29-/m1/s1 |
| InChIKey | PIPHBSPEYJJVGC-QZZDXIJXSA-N |
| XLogP | 5.42 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |