C33H30N4O — CID 135131614
(6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-(3-propan-2-ylphenyl)-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131614) has the molecular formula C33H30N4O and a molecular weight of 498.63 g/mol. Its IUPAC name is (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-(3-propan-2-ylphenyl)-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-(3-propan-2-ylphenyl)-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131614 |
| Molecular Formula | C33H30N4O |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-(3-propan-2-ylphenyl)-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | CC(C)c1cccc(-c2nc(-c3ccnc4ccccc34)nc3c2CC[C@@H]2[C@@H](C)C(=O)C(C#N)=C[C@@]32C)c1 |
| InChI | InChI=1S/C33H30N4O/c1-19(2)21-8-7-9-22(16-21)29-26-12-13-27-20(3)30(38)23(18-34)17-33(27,4)31(26)37-32(36-29)25-14-15-35-28-11-6-5-10-24(25)28/h5-11,14-17,19-20,27H,12-13H2,1-4H3/t20-,27-,33-/m1/s1 |
| InChIKey | OVQVLTAZQMWBQA-AKRQDAIGSA-N |
| XLogP | 6.97 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |