C28H27N5O — CID 135131891
(6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-pyrrolidin-1-yl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131891) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-pyrrolidin-1-yl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-pyrrolidin-1-yl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131891 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-pyrrolidin-1-yl-2-quinolin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccnc5ccccc45)nc(N4CCCC4)c3CC[C@H]12 |
| InChI | InChI=1S/C28H27N5O/c1-17-22-10-9-21-25(28(22,2)15-18(16-29)24(17)34)31-26(32-27(21)33-13-5-6-14-33)20-11-12-30-23-8-4-3-7-19(20)23/h3-4,7-8,11-12,15,17,22H,5-6,9-10,13-14H2,1-2H3/t17-,22-,28-/m1/s1 |
| InChIKey | HVOMKMXJDWACID-DHBJDBKLSA-N |
| XLogP | 4.78 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |