C31H25FN4O2 — CID 135131742
(6aR,7R,10aS)-4-(2-fluorophenyl)-2-[2-(hydroxymethyl)quinolin-4-yl]-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131742) has the molecular formula C31H25FN4O2 and a molecular weight of 504.57 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-2-[2-(hydroxymethyl)quinolin-4-yl]-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-2-[2-(hydroxymethyl)quinolin-4-yl]-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131742 |
| Molecular Formula | C31H25FN4O2 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-2-[2-(hydroxymethyl)quinolin-4-yl]-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4cc(CO)nc5ccccc45)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C31H25FN4O2/c1-17-24-12-11-22-27(21-8-3-5-9-25(21)32)35-30(36-29(22)31(24,2)14-18(15-33)28(17)38)23-13-19(16-37)34-26-10-6-4-7-20(23)26/h3-10,13-14,17,24,37H,11-12,16H2,1-2H3/t17-,24-,31-/m1/s1 |
| InChIKey | POQJBWMBLZXPBA-HXIGGIJRSA-N |
| XLogP | 5.48 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |