C27H26N6O3 — CID 137293856
(6aR,7R,11aR)-N-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-7,11a-dimethyl-2-quinolin-4-yl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline-4-carboxamide (PubChem CID 137293856) has the molecular formula C27H26N6O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is (6aR,7R,11aR)-N-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-7,11a-dimethyl-2-quinolin-4-yl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline-4-carboxamide.
| Compound Name | (6aR,7R,11aR)-N-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-7,11a-dimethyl-2-quinolin-4-yl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 137293856 |
| Molecular Formula | C27H26N6O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (6aR,7R,11aR)-N-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-7,11a-dimethyl-2-quinolin-4-yl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline-4-carboxamide |
| SMILES | C/C(=N/O)NC(=O)c1nc(-c2ccnc3ccccc23)nc2c1CC[C@@H]1[C@@H](C)c3oncc3C[C@@]21C |
| InChI | InChI=1S/C27H26N6O3/c1-14-20-9-8-19-22(26(34)30-15(2)33-35)31-25(18-10-11-28-21-7-5-4-6-17(18)21)32-24(19)27(20,3)12-16-13-29-36-23(14)16/h4-7,10-11,13-14,20,35H,8-9,12H2,1-3H3,(H,30,33,34)/t14-,20-,27-/m1/s1 |
| InChIKey | ZHWYQRBKEJPWHK-FJXHSAOVSA-N |
| XLogP | 4.40 |
| TPSA | 126.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|