C31H33N3O — CID 157053822
(5aR,6R,10aR)-3-(cyclobutylmethyl)-6,10a-dimethyl-2-(4-phenylphenyl)-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazole (PubChem CID 157053822) has the molecular formula C31H33N3O and a molecular weight of 463.63 g/mol. Its IUPAC name is (5aR,6R,10aR)-3-(cyclobutylmethyl)-6,10a-dimethyl-2-(4-phenylphenyl)-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazole.
| Compound Name | (5aR,6R,10aR)-3-(cyclobutylmethyl)-6,10a-dimethyl-2-(4-phenylphenyl)-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazole |
|---|---|
| PubChem CID | 157053822 |
| Molecular Formula | C31H33N3O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | (5aR,6R,10aR)-3-(cyclobutylmethyl)-6,10a-dimethyl-2-(4-phenylphenyl)-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazole |
| SMILES | C[C@H]1c2oncc2C[C@@]2(C)c3nn(-c4ccc(-c5ccccc5)cc4)c(CC4CCC4)c3CC[C@H]12 |
| InChI | InChI=1S/C31H33N3O/c1-20-27-16-15-26-28(17-21-7-6-8-21)34(25-13-11-23(12-14-25)22-9-4-3-5-10-22)33-30(26)31(27,2)18-24-19-32-35-29(20)24/h3-5,9-14,19-21,27H,6-8,15-18H2,1-2H3/t20-,27-,31-/m1/s1 |
| InChIKey | AANALPQWCOBCQU-QDSGMSMLSA-N |
| XLogP | 7.05 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |