C25H25N5O — CID 118290975
(6aS,7S,11aS)-2,7-dimethyl-4-(3-methylimidazol-4-yl)-11a-phenyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline (PubChem CID 118290975) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is (6aS,7S,11aS)-2,7-dimethyl-4-(3-methylimidazol-4-yl)-11a-phenyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline.
| Compound Name | (6aS,7S,11aS)-2,7-dimethyl-4-(3-methylimidazol-4-yl)-11a-phenyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline |
|---|---|
| PubChem CID | 118290975 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (6aS,7S,11aS)-2,7-dimethyl-4-(3-methylimidazol-4-yl)-11a-phenyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline |
| SMILES | Cc1nc(-c2cncn2C)c2c(n1)[C@@]1(c3ccccc3)Cc3cnoc3[C@@H](C)[C@@H]1CC2 |
| InChI | InChI=1S/C25H25N5O/c1-15-20-10-9-19-22(21-13-26-14-30(21)3)28-16(2)29-24(19)25(20,18-7-5-4-6-8-18)11-17-12-27-31-23(15)17/h4-8,12-15,20H,9-11H2,1-3H3/t15-,20-,25+/m0/s1 |
| InChIKey | JSQRBZLOUSYLJY-PCKXHRCSSA-N |
| XLogP | 4.38 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |