C25H22N4O — CID 118290956
(6aS,7S,11aS)-7-methyl-11a-phenyl-2-pyridin-4-yl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline (PubChem CID 118290956) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is (6aS,7S,11aS)-7-methyl-11a-phenyl-2-pyridin-4-yl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline.
| Compound Name | (6aS,7S,11aS)-7-methyl-11a-phenyl-2-pyridin-4-yl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline |
|---|---|
| PubChem CID | 118290956 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (6aS,7S,11aS)-7-methyl-11a-phenyl-2-pyridin-4-yl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazoline |
| SMILES | C[C@@H]1c2oncc2C[C@]2(c3ccccc3)c3nc(-c4ccncc4)ncc3CC[C@@H]12 |
| InChI | InChI=1S/C25H22N4O/c1-16-21-8-7-18-14-27-24(17-9-11-26-12-10-17)29-23(18)25(21,20-5-3-2-4-6-20)13-19-15-28-30-22(16)19/h2-6,9-12,14-16,21H,7-8,13H2,1H3/t16-,21-,25+/m0/s1 |
| InChIKey | ZBIZQNIJCDABAD-WZSOFCAESA-N |
| XLogP | 4.73 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |