C24H21N5O — CID 175177130
(6aS,7S,10aR)-7-methyl-8-oxo-10a-phenyl-2-pyrimidin-5-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 175177130) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is (6aS,7S,10aR)-7-methyl-8-oxo-10a-phenyl-2-pyrimidin-5-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aS,7S,10aR)-7-methyl-8-oxo-10a-phenyl-2-pyrimidin-5-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 175177130 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (6aS,7S,10aR)-7-methyl-8-oxo-10a-phenyl-2-pyrimidin-5-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)C[C@@]2(c3ccccc3)c3nc(-c4cncnc4)ncc3CC[C@@H]12 |
| InChI | InChI=1S/C24H21N5O/c1-15-20-8-7-16-13-28-23(18-11-26-14-27-12-18)29-22(16)24(20,9-17(10-25)21(15)30)19-5-3-2-4-6-19/h2-6,11-15,17,20H,7-9H2,1H3/t15-,17?,20-,24-/m0/s1 |
| InChIKey | IWUZRDHSNIJDCX-QGBYRXKYSA-N |
| XLogP | 3.53 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|