C25H23N5O2 — CID 175183722
(6S,9aR)-8-cyano-6-methyl-7-oxo-9a-phenyl-N-pyridin-3-yl-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-2-carboxamide (PubChem CID 175183722) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is (6S,9aR)-8-cyano-6-methyl-7-oxo-9a-phenyl-N-pyridin-3-yl-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-2-carboxamide.
| Compound Name | (6S,9aR)-8-cyano-6-methyl-7-oxo-9a-phenyl-N-pyridin-3-yl-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-2-carboxamide |
|---|---|
| PubChem CID | 175183722 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (6S,9aR)-8-cyano-6-methyl-7-oxo-9a-phenyl-N-pyridin-3-yl-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-2-carboxamide |
| SMILES | C[C@@H]1C(=O)C(C#N)C[C@@]2(c3ccccc3)c3nn(C(=O)Nc4cccnc4)cc3CCC12 |
| InChI | InChI=1S/C25H23N5O2/c1-16-21-10-9-17-15-30(24(32)28-20-8-5-11-27-14-20)29-23(17)25(21,12-18(13-26)22(16)31)19-6-3-2-4-7-19/h2-8,11,14-16,18,21H,9-10,12H2,1H3,(H,28,32)/t16-,18?,21?,25-/m0/s1 |
| InChIKey | JKQLLZAJHZSQBS-QIEKJRDRSA-N |
| XLogP | 3.96 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|