C35H31N3O3 — CID 118291363
methyl 4-[3-[(6aS,7S,10aS)-9-cyano-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-4-yl]phenyl]benzoate (PubChem CID 118291363) has the molecular formula C35H31N3O3 and a molecular weight of 541.65 g/mol. Its IUPAC name is methyl 4-[3-[(6aS,7S,10aS)-9-cyano-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-4-yl]phenyl]benzoate.
| Compound Name | methyl 4-[3-[(6aS,7S,10aS)-9-cyano-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-4-yl]phenyl]benzoate |
|---|---|
| PubChem CID | 118291363 |
| Molecular Formula | C35H31N3O3 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | methyl 4-[3-[(6aS,7S,10aS)-9-cyano-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-4-yl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cccc(-c3nc(C)nc4c3CC[C@H]3[C@H](C)C(=O)C(C#N)C[C@]43c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C35H31N3O3/c1-21-30-17-16-29-31(26-9-7-8-25(18-26)23-12-14-24(15-13-23)34(40)41-3)37-22(2)38-33(29)35(30,19-27(20-36)32(21)39)28-10-5-4-6-11-28/h4-15,18,21,27,30H,16-17,19H2,1-3H3/t21-,27?,30-,35+/m0/s1 |
| InChIKey | WCGKQTWOIXBGEC-ABSMIKBPSA-N |
| XLogP | 6.50 |
| TPSA | 92.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|