C29H28N4O3 — CID 118291564
(6aS,7S,9Z,10aS)-4-(3H-benzimidazol-5-yl)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-2,7-dimethyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one (PubChem CID 118291564) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is (6aS,7S,9Z,10aS)-4-(3H-benzimidazol-5-yl)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-2,7-dimethyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S,9Z,10aS)-4-(3H-benzimidazol-5-yl)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-2,7-dimethyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 118291564 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | (6aS,7S,9Z,10aS)-4-(3H-benzimidazol-5-yl)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-2,7-dimethyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
| SMILES | COc1ccc([C@]23C/C(=C/O)C(=O)[C@@H](C)[C@@H]2CCc2c(-c4ccc5nc[nH]c5c4)nc(C)nc23)cc1 |
| InChI | InChI=1S/C29H28N4O3/c1-16-23-10-9-22-26(18-4-11-24-25(12-18)31-15-30-24)32-17(2)33-28(22)29(23,13-19(14-34)27(16)35)20-5-7-21(36-3)8-6-20/h4-8,11-12,14-16,23,34H,9-10,13H2,1-3H3,(H,30,31)/b19-14-/t16-,23-,29+/m0/s1 |
| InChIKey | ZQSAQGSORHEDPM-ALLQNURISA-N |
| XLogP | 5.24 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|