C23H24N2O4 — CID 118291392
ethyl 4-[(6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-7-methyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-10a-yl]benzoate (PubChem CID 118291392) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl 4-[(6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-7-methyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-10a-yl]benzoate.
| Compound Name | ethyl 4-[(6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-7-methyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-10a-yl]benzoate |
|---|---|
| PubChem CID | 118291392 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | ethyl 4-[(6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-7-methyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-10a-yl]benzoate |
| SMILES | CCOC(=O)c1ccc([C@]23C/C(=C/O)C(=O)[C@@H](C)[C@@H]2CCc2cncnc23)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-3-29-22(28)15-4-7-18(8-5-15)23-10-17(12-26)20(27)14(2)19(23)9-6-16-11-24-13-25-21(16)23/h4-5,7-8,11-14,19,26H,3,6,9-10H2,1-2H3/b17-12-/t14-,19-,23+/m0/s1 |
| InChIKey | IEEKJLLPWRCQHH-CJKMUHSGSA-N |
| XLogP | 3.55 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|