C28H25N5O — CID 118291115
(6aS,7S,10aS)-4-imidazo[1,2-a]pyridin-6-yl-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 118291115) has the molecular formula C28H25N5O and a molecular weight of 447.54 g/mol. Its IUPAC name is (6aS,7S,10aS)-4-imidazo[1,2-a]pyridin-6-yl-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aS,7S,10aS)-4-imidazo[1,2-a]pyridin-6-yl-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 118291115 |
| Molecular Formula | C28H25N5O |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (6aS,7S,10aS)-4-imidazo[1,2-a]pyridin-6-yl-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | Cc1nc(-c2ccc3nccn3c2)c2c(n1)[C@@]1(c3ccccc3)CC(C#N)C(=O)[C@@H](C)[C@@H]1CC2 |
| InChI | InChI=1S/C28H25N5O/c1-17-23-10-9-22-25(19-8-11-24-30-12-13-33(24)16-19)31-18(2)32-27(22)28(23,14-20(15-29)26(17)34)21-6-4-3-5-7-21/h3-8,11-13,16-17,20,23H,9-10,14H2,1-2H3/t17-,20?,23-,28+/m0/s1 |
| InChIKey | REQLVFKXQMQGCE-FOZQZVDESA-N |
| XLogP | 4.70 |
| TPSA | 83.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|