C23H21N5O — CID 118257576
(9aS)-6-methyl-7-oxo-9a-phenyl-3-pyrimidin-5-yl-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile (PubChem CID 118257576) has the molecular formula C23H21N5O and a molecular weight of 383.45 g/mol. Its IUPAC name is (9aS)-6-methyl-7-oxo-9a-phenyl-3-pyrimidin-5-yl-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile.
| Compound Name | (9aS)-6-methyl-7-oxo-9a-phenyl-3-pyrimidin-5-yl-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 118257576 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (9aS)-6-methyl-7-oxo-9a-phenyl-3-pyrimidin-5-yl-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile |
| SMILES | CC1C(=O)C(C#N)C[C@]2(c3ccccc3)c3[nH]nc(-c4cncnc4)c3CCC12 |
| InChI | InChI=1S/C23H21N5O/c1-14-19-8-7-18-20(16-11-25-13-26-12-16)27-28-22(18)23(19,9-15(10-24)21(14)29)17-5-3-2-4-6-17/h2-6,11-15,19H,7-9H2,1H3,(H,27,28)/t14?,15?,19?,23-/m1/s1 |
| InChIKey | MLMKMVHHFGJQIL-KMKZJGACSA-N |
| XLogP | 3.46 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|