C21H21N3O3 — CID 118291769
methyl 3-[(5aR,6S,9aR)-8-cyano-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazol-9a-yl]benzoate (PubChem CID 118291769) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 3-[(5aR,6S,9aR)-8-cyano-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazol-9a-yl]benzoate.
| Compound Name | methyl 3-[(5aR,6S,9aR)-8-cyano-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazol-9a-yl]benzoate |
|---|---|
| PubChem CID | 118291769 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 3-[(5aR,6S,9aR)-8-cyano-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazol-9a-yl]benzoate |
| SMILES | COC(=O)c1cccc([C@@]23CC(C#N)C(=O)[C@@H](C)[C@H]2CCc2cn[nH]c23)c1 |
| InChI | InChI=1S/C21H21N3O3/c1-12-17-7-6-14-11-23-24-19(14)21(17,9-15(10-22)18(12)25)16-5-3-4-13(8-16)20(26)27-2/h3-5,8,11-12,15,17H,6-7,9H2,1-2H3,(H,23,24)/t12-,15?,17+,21-/m0/s1 |
| InChIKey | LOSRUECORCAYGL-XAQLGRJKSA-N |
| XLogP | 2.79 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|