C28H28FN3O2 — CID 118291687
(5aS,6S,9aS)-9a-(3-fluorophenyl)-3-[3-(3-hydroxypropyl)phenyl]-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile (PubChem CID 118291687) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is (5aS,6S,9aS)-9a-(3-fluorophenyl)-3-[3-(3-hydroxypropyl)phenyl]-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aS)-9a-(3-fluorophenyl)-3-[3-(3-hydroxypropyl)phenyl]-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 118291687 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (5aS,6S,9aS)-9a-(3-fluorophenyl)-3-[3-(3-hydroxypropyl)phenyl]-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)C[C@]2(c3cccc(F)c3)c3[nH]nc(-c4cccc(CCCO)c4)c3CC[C@@H]12 |
| InChI | InChI=1S/C28H28FN3O2/c1-17-24-11-10-23-25(19-7-2-5-18(13-19)6-4-12-33)31-32-27(23)28(24,15-20(16-30)26(17)34)21-8-3-9-22(29)14-21/h2-3,5,7-9,13-14,17,20,24,33H,4,6,10-12,15H2,1H3,(H,31,32)/t17-,20?,24-,28+/m0/s1 |
| InChIKey | LBDRPNSNUFWAJA-LFMAZUQSSA-N |
| XLogP | 4.74 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|