C14H15FN2 — CID 165488273
3-(3-fluorophenyl)-5-methyl-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 165488273) has the molecular formula C14H15FN2 and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-methyl-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | 3-(3-fluorophenyl)-5-methyl-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 165488273 |
| Molecular Formula | C14H15FN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-(3-fluorophenyl)-5-methyl-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | CC1CCc2[nH]nc(-c3cccc(F)c3)c2C1 |
| InChI | InChI=1S/C14H15FN2/c1-9-5-6-13-12(7-9)14(17-16-13)10-3-2-4-11(15)8-10/h2-4,8-9H,5-7H2,1H3,(H,16,17) |
| InChIKey | QYMMQFQIJBVIIZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |