C12H11FN2S — CID 106515408
3-(3-fluorophenyl)-4,5-dimethyl-1H-pyridazine-6-thione (PubChem CID 106515408) has the molecular formula C12H11FN2S and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-4,5-dimethyl-1H-pyridazine-6-thione.
| Compound Name | 3-(3-fluorophenyl)-4,5-dimethyl-1H-pyridazine-6-thione |
|---|---|
| PubChem CID | 106515408 |
| Molecular Formula | C12H11FN2S |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-(3-fluorophenyl)-4,5-dimethyl-1H-pyridazine-6-thione |
| SMILES | Cc1c(-c2cccc(F)c2)n[nH]c(=S)c1C |
| InChI | InChI=1S/C12H11FN2S/c1-7-8(2)12(16)15-14-11(7)9-4-3-5-10(13)6-9/h3-6H,1-2H3,(H,15,16) |
| InChIKey | MLHWQRWGJVFQQK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|