C24H20N4O — CID 118291883
(5aS,6S,9aR)-6-methyl-7-oxo-9a-phenyl-3-pyridin-3-yl-4,5,5a,6-tetrahydro-1H-benzo[g]indazole-8-carbonitrile (PubChem CID 118291883) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is (5aS,6S,9aR)-6-methyl-7-oxo-9a-phenyl-3-pyridin-3-yl-4,5,5a,6-tetrahydro-1H-benzo[g]indazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-6-methyl-7-oxo-9a-phenyl-3-pyridin-3-yl-4,5,5a,6-tetrahydro-1H-benzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 118291883 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (5aS,6S,9aR)-6-methyl-7-oxo-9a-phenyl-3-pyridin-3-yl-4,5,5a,6-tetrahydro-1H-benzo[g]indazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(c3ccccc3)c3[nH]nc(-c4cccnc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C24H20N4O/c1-15-20-10-9-19-21(16-6-5-11-26-14-16)27-28-23(19)24(20,12-17(13-25)22(15)29)18-7-3-2-4-8-18/h2-8,11-12,14-15,20H,9-10H2,1H3,(H,27,28)/t15-,20-,24+/m0/s1 |
| InChIKey | IPWFTHOLAOQTTB-IJHUGTEESA-N |
| XLogP | 3.99 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |