C26H25N3O — CID 118291012
(3R,3aR,5aS,6S,9aR)-2,6-dimethyl-7-oxo-3,9a-diphenyl-3,3a,4,5,5a,6-hexahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 118291012) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is (3R,3aR,5aS,6S,9aR)-2,6-dimethyl-7-oxo-3,9a-diphenyl-3,3a,4,5,5a,6-hexahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (3R,3aR,5aS,6S,9aR)-2,6-dimethyl-7-oxo-3,9a-diphenyl-3,3a,4,5,5a,6-hexahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 118291012 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (3R,3aR,5aS,6S,9aR)-2,6-dimethyl-7-oxo-3,9a-diphenyl-3,3a,4,5,5a,6-hexahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(c3ccccc3)C3=NN(C)[C@@H](c4ccccc4)[C@H]3CC[C@@H]12 |
| InChI | InChI=1S/C26H25N3O/c1-17-22-14-13-21-23(18-9-5-3-6-10-18)29(2)28-25(21)26(22,15-19(16-27)24(17)30)20-11-7-4-8-12-20/h3-12,15,17,21-23H,13-14H2,1-2H3/t17-,21+,22-,23-,26+/m0/s1 |
| InChIKey | PHHUGDPJCDSLDA-AAWWAGDNSA-N |
| XLogP | 4.66 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |