C19H18F2N2O2 — CID 135188017
(4aS,5S,8aR)-2-(2,2-difluoroethyl)-5-methyl-1,6-dioxo-8a-phenyl-3,4,4a,5-tetrahydroisoquinoline-7-carbonitrile (PubChem CID 135188017) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is (4aS,5S,8aR)-2-(2,2-difluoroethyl)-5-methyl-1,6-dioxo-8a-phenyl-3,4,4a,5-tetrahydroisoquinoline-7-carbonitrile.
| Compound Name | (4aS,5S,8aR)-2-(2,2-difluoroethyl)-5-methyl-1,6-dioxo-8a-phenyl-3,4,4a,5-tetrahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 135188017 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4aS,5S,8aR)-2-(2,2-difluoroethyl)-5-methyl-1,6-dioxo-8a-phenyl-3,4,4a,5-tetrahydroisoquinoline-7-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(c3ccccc3)C(=O)N(CC(F)F)CC[C@@H]12 |
| InChI | InChI=1S/C19H18F2N2O2/c1-12-15-7-8-23(11-16(20)21)18(25)19(15,9-13(10-22)17(12)24)14-5-3-2-4-6-14/h2-6,9,12,15-16H,7-8,11H2,1H3/t12-,15-,19+/m0/s1 |
| InChIKey | HANQRNLPCFPOKY-VRHCTWJESA-N |
| XLogP | 2.71 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |