C21H19N3O3 — CID 118257413
(5aR,6R,9aR)-2-(2-hydroxyacetyl)-6-methyl-7-oxo-9a-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 118257413) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is (5aR,6R,9aR)-2-(2-hydroxyacetyl)-6-methyl-7-oxo-9a-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aR)-2-(2-hydroxyacetyl)-6-methyl-7-oxo-9a-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 118257413 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (5aR,6R,9aR)-2-(2-hydroxyacetyl)-6-methyl-7-oxo-9a-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@]2(c3ccccc3)c3nn(C(=O)CO)cc3CC[C@H]12 |
| InChI | InChI=1S/C21H19N3O3/c1-13-17-8-7-14-11-24(18(26)12-25)23-20(14)21(17,9-15(10-22)19(13)27)16-5-3-2-4-6-16/h2-6,9,11,13,17,25H,7-8,12H2,1H3/t13-,17-,21-/m1/s1 |
| InChIKey | BCZLHEKPDBAGID-QKAVXHIFSA-N |
| XLogP | 2.03 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |