C27H21N3O3 — CID 118291739
3-[(6aS,7S,10aR)-9-cyano-7-methyl-8-oxo-2-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-10a-yl]benzoic acid (PubChem CID 118291739) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[(6aS,7S,10aR)-9-cyano-7-methyl-8-oxo-2-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-10a-yl]benzoic acid.
| Compound Name | 3-[(6aS,7S,10aR)-9-cyano-7-methyl-8-oxo-2-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-10a-yl]benzoic acid |
|---|---|
| PubChem CID | 118291739 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-[(6aS,7S,10aR)-9-cyano-7-methyl-8-oxo-2-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-10a-yl]benzoic acid |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(c3cccc(C(=O)O)c3)c3nc(-c4ccccc4)ncc3CC[C@@H]12 |
| InChI | InChI=1S/C27H21N3O3/c1-16-22-11-10-19-15-29-25(17-6-3-2-4-7-17)30-24(19)27(22,13-20(14-28)23(16)31)21-9-5-8-18(12-21)26(32)33/h2-9,12-13,15-16,22H,10-11H2,1H3,(H,32,33)/t16-,22-,27+/m0/s1 |
| InChIKey | LHMQUBJXHJBAJU-UWYNZWELSA-N |
| XLogP | 4.36 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |