C27H22N4O2 — CID 118291708
3-[(6aS,7S,10aR)-9-cyano-7-methyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazolin-10a-yl]-N-phenylbenzamide (PubChem CID 118291708) has the molecular formula C27H22N4O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-[(6aS,7S,10aR)-9-cyano-7-methyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazolin-10a-yl]-N-phenylbenzamide.
| Compound Name | 3-[(6aS,7S,10aR)-9-cyano-7-methyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazolin-10a-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 118291708 |
| Molecular Formula | C27H22N4O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-[(6aS,7S,10aR)-9-cyano-7-methyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazolin-10a-yl]-N-phenylbenzamide |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(c3cccc(C(=O)Nc4ccccc4)c3)c3ncncc3CC[C@@H]12 |
| InChI | InChI=1S/C27H22N4O2/c1-17-23-11-10-19-15-29-16-30-25(19)27(23,13-20(14-28)24(17)32)21-7-5-6-18(12-21)26(33)31-22-8-3-2-4-9-22/h2-9,12-13,15-17,23H,10-11H2,1H3,(H,31,33)/t17-,23-,27+/m0/s1 |
| InChIKey | LLWALXROCMJIGS-XMFBKKLCSA-N |
| XLogP | 4.25 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |