C31H29N3O3 — CID 118291045
methyl 3-[3-[(6aS,7S,10aR)-9-cyano-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-4-yl]phenyl]propanoate (PubChem CID 118291045) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is methyl 3-[3-[(6aS,7S,10aR)-9-cyano-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-4-yl]phenyl]propanoate.
| Compound Name | methyl 3-[3-[(6aS,7S,10aR)-9-cyano-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-4-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 118291045 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | methyl 3-[3-[(6aS,7S,10aR)-9-cyano-2,7-dimethyl-8-oxo-10a-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-4-yl]phenyl]propanoate |
| SMILES | COC(=O)CCc1cccc(-c2nc(C)nc3c2CC[C@H]2[C@H](C)C(=O)C(C#N)=C[C@]32c2ccccc2)c1 |
| InChI | InChI=1S/C31H29N3O3/c1-19-26-14-13-25-28(22-9-7-8-21(16-22)12-15-27(35)37-3)33-20(2)34-30(25)31(26,17-23(18-32)29(19)36)24-10-5-4-6-11-24/h4-11,16-17,19,26H,12-15H2,1-3H3/t19-,26-,31+/m0/s1 |
| InChIKey | DLEHWDYKKAJEAJ-VVIOKTKKSA-N |
| XLogP | 5.07 |
| TPSA | 92.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |