C24H21FN2O2 — CID 153279186
(4aS,5S,8aR)-2-[(2-fluorophenyl)methyl]-7-isocyano-5-methyl-8a-phenyl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione (PubChem CID 153279186) has the molecular formula C24H21FN2O2 and a molecular weight of 388.44 g/mol. Its IUPAC name is (4aS,5S,8aR)-2-[(2-fluorophenyl)methyl]-7-isocyano-5-methyl-8a-phenyl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione.
| Compound Name | (4aS,5S,8aR)-2-[(2-fluorophenyl)methyl]-7-isocyano-5-methyl-8a-phenyl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione |
|---|---|
| PubChem CID | 153279186 |
| Molecular Formula | C24H21FN2O2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (4aS,5S,8aR)-2-[(2-fluorophenyl)methyl]-7-isocyano-5-methyl-8a-phenyl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(c3ccccc3)C(=O)N(Cc3ccccc3F)CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C24H21FN2O2/c1-16-19-12-13-27(15-17-8-6-7-11-20(17)25)23(29)24(19,14-21(26-2)22(16)28)18-9-4-3-5-10-18/h3-11,14,16,19H,12-13,15H2,1H3/t16-,19-,24+/m0/s1 |
| InChIKey | PVETVFJDCUKODS-TVVUZDRGSA-N |
| XLogP | 4.13 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|