C21H20N2O2 — CID 153279138
(8aS)-2-cyclopropyl-7-isocyano-5,5-dimethyl-8a-phenyl-3H-isoquinoline-1,6-dione (PubChem CID 153279138) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (8aS)-2-cyclopropyl-7-isocyano-5,5-dimethyl-8a-phenyl-3H-isoquinoline-1,6-dione.
| Compound Name | (8aS)-2-cyclopropyl-7-isocyano-5,5-dimethyl-8a-phenyl-3H-isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 153279138 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (8aS)-2-cyclopropyl-7-isocyano-5,5-dimethyl-8a-phenyl-3H-isoquinoline-1,6-dione |
| SMILES | [C-]#[N+]C1=C[C@@]2(c3ccccc3)C(=O)N(C3CC3)CC=C2C(C)(C)C1=O |
| InChI | InChI=1S/C21H20N2O2/c1-20(2)17-11-12-23(15-9-10-15)19(25)21(17,13-16(22-3)18(20)24)14-7-5-4-6-8-14/h4-8,11,13,15H,9-10,12H2,1-2H3/t21-/m0/s1 |
| InChIKey | RDIBJFKWRSOHTF-NRFANRHFSA-N |
| XLogP | 3.27 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|