C19H17FN2O2 — CID 153279168
(8aS)-8a-(3-fluorophenyl)-7-isocyano-2,5,5-trimethyl-3H-isoquinoline-1,6-dione (PubChem CID 153279168) has the molecular formula C19H17FN2O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is (8aS)-8a-(3-fluorophenyl)-7-isocyano-2,5,5-trimethyl-3H-isoquinoline-1,6-dione.
| Compound Name | (8aS)-8a-(3-fluorophenyl)-7-isocyano-2,5,5-trimethyl-3H-isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 153279168 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (8aS)-8a-(3-fluorophenyl)-7-isocyano-2,5,5-trimethyl-3H-isoquinoline-1,6-dione |
| SMILES | [C-]#[N+]C1=C[C@@]2(c3cccc(F)c3)C(=O)N(C)CC=C2C(C)(C)C1=O |
| InChI | InChI=1S/C19H17FN2O2/c1-18(2)15-8-9-22(4)17(24)19(15,11-14(21-3)16(18)23)12-6-5-7-13(20)10-12/h5-8,10-11H,9H2,1-2,4H3/t19-/m0/s1 |
| InChIKey | BFXZJARPMJIMBM-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|