C21H18N4O2 — CID 153279260
(4aR,5R,8aS)-7-isocyano-5-methyl-8a-phenyl-2-pyrimidin-4-yl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione (PubChem CID 153279260) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is (4aR,5R,8aS)-7-isocyano-5-methyl-8a-phenyl-2-pyrimidin-4-yl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione.
| Compound Name | (4aR,5R,8aS)-7-isocyano-5-methyl-8a-phenyl-2-pyrimidin-4-yl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione |
|---|---|
| PubChem CID | 153279260 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (4aR,5R,8aS)-7-isocyano-5-methyl-8a-phenyl-2-pyrimidin-4-yl-3,4,4a,5-tetrahydroisoquinoline-1,6-dione |
| SMILES | [C-]#[N+]C1=C[C@@]2(c3ccccc3)C(=O)N(c3ccncn3)CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C21H18N4O2/c1-14-16-9-11-25(18-8-10-23-13-24-18)20(27)21(16,12-17(22-2)19(14)26)15-6-4-3-5-7-15/h3-8,10,12-14,16H,9,11H2,1H3/t14-,16-,21+/m1/s1 |
| InChIKey | QLGSNSPIDNSGLP-NVAPDCRFSA-N |
| XLogP | 2.79 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|