C26H22ClN3O — CID 156685420
(5aR,6R,9aS)-2-(4-chlorophenyl)-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one (PubChem CID 156685420) has the molecular formula C26H22ClN3O and a molecular weight of 427.94 g/mol. Its IUPAC name is (5aR,6R,9aS)-2-(4-chlorophenyl)-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one.
| Compound Name | (5aR,6R,9aS)-2-(4-chlorophenyl)-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 156685420 |
| Molecular Formula | C26H22ClN3O |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (5aR,6R,9aS)-2-(4-chlorophenyl)-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nn(-c4ccc(Cl)cc4)c(-c4ccccc4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C26H22ClN3O/c1-16-21-14-13-20-23(17-7-5-4-6-8-17)30(19-11-9-18(27)10-12-19)29-25(20)26(21,2)15-22(28-3)24(16)31/h4-12,15-16,21H,13-14H2,1-2H3/t16-,21-,26-/m1/s1 |
| InChIKey | ZHZYZJLLVGBPKE-LNHOJHAFSA-N |
| XLogP | 6.03 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|