C31H28N4O2 — CID 156685394
(5aR,6R,9aS)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one (PubChem CID 156685394) has the molecular formula C31H28N4O2 and a molecular weight of 488.59 g/mol. Its IUPAC name is (5aR,6R,9aS)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one.
| Compound Name | (5aR,6R,9aS)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 156685394 |
| Molecular Formula | C31H28N4O2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (5aR,6R,9aS)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3c(c(-c4ccccc4)nn3-c3ccc(-c4c(C)noc4C)cc3)CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C31H28N4O2/c1-18-25-16-15-24-28(22-9-7-6-8-10-22)33-35(30(24)31(25,4)17-26(32-5)29(18)36)23-13-11-21(12-14-23)27-19(2)34-37-20(27)3/h6-14,17-18,25H,15-16H2,1-4H3/t18-,25-,31-/m1/s1 |
| InChIKey | VGEPAGZVIGQMSK-XOERONJASA-N |
| XLogP | 6.65 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|