C24H25N3O3S — CID 156685397
(5aR,6R,9aS)-2-(1,1-dioxothiolan-3-yl)-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one (PubChem CID 156685397) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is (5aR,6R,9aS)-2-(1,1-dioxothiolan-3-yl)-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one.
| Compound Name | (5aR,6R,9aS)-2-(1,1-dioxothiolan-3-yl)-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 156685397 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (5aR,6R,9aS)-2-(1,1-dioxothiolan-3-yl)-8-isocyano-6,9a-dimethyl-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nn(C4CCS(=O)(=O)C4)c(-c4ccccc4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C24H25N3O3S/c1-15-19-10-9-18-21(16-7-5-4-6-8-16)27(17-11-12-31(29,30)14-17)26-23(18)24(19,2)13-20(25-3)22(15)28/h4-8,13,15,17,19H,9-12,14H2,1-2H3/t15-,17?,19-,24-/m1/s1 |
| InChIKey | PHVDGDCIHJCKLM-JLMPOUQOSA-N |
| XLogP | 3.75 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|